C20H23N3O — CID 92574940
(4R,5S)-2-benzyl-4-pyridin-3-yl-2,6-diazaspiro[4.5]decan-7-one (PubChem CID 92574940) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is (4R,5S)-2-benzyl-4-pyridin-3-yl-2,6-diazaspiro[4.5]decan-7-one.
| Compound Name | (4R,5S)-2-benzyl-4-pyridin-3-yl-2,6-diazaspiro[4.5]decan-7-one |
|---|---|
| PubChem CID | 92574940 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | (4R,5S)-2-benzyl-4-pyridin-3-yl-2,6-diazaspiro[4.5]decan-7-one |
| SMILES | O=C1CCC[C@]2(CN(Cc3ccccc3)C[C@H]2c2cccnc2)N1 |
| InChI | InChI=1S/C20H23N3O/c24-19-9-4-10-20(22-19)15-23(13-16-6-2-1-3-7-16)14-18(20)17-8-5-11-21-12-17/h1-3,5-8,11-12,18H,4,9-10,13-15H2,(H,22,24)/t18-,20+/m0/s1 |
| InChIKey | RQCZVUNGZDNNME-AZUAARDMSA-N |
| XLogP | 2.72 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |