C18H26N4O3S — CID 92570749
(4R,5S)-2-piperidin-1-ylsulfonyl-4-pyridin-3-yl-2,6-diazaspiro[4.5]decan-7-one (PubChem CID 92570749) has the molecular formula C18H26N4O3S and a molecular weight of 378.50 g/mol. Its IUPAC name is (4R,5S)-2-piperidin-1-ylsulfonyl-4-pyridin-3-yl-2,6-diazaspiro[4.5]decan-7-one.
| Compound Name | (4R,5S)-2-piperidin-1-ylsulfonyl-4-pyridin-3-yl-2,6-diazaspiro[4.5]decan-7-one |
|---|---|
| PubChem CID | 92570749 |
| Molecular Formula | C18H26N4O3S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (4R,5S)-2-piperidin-1-ylsulfonyl-4-pyridin-3-yl-2,6-diazaspiro[4.5]decan-7-one |
| SMILES | O=C1CCC[C@]2(CN(S(=O)(=O)N3CCCCC3)C[C@H]2c2cccnc2)N1 |
| InChI | InChI=1S/C18H26N4O3S/c23-17-7-4-8-18(20-17)14-22(13-16(18)15-6-5-9-19-12-15)26(24,25)21-10-2-1-3-11-21/h5-6,9,12,16H,1-4,7-8,10-11,13-14H2,(H,20,23)/t16-,18+/m0/s1 |
| InChIKey | PVFKHSSCLULWBN-FUHWJXTLSA-N |
| XLogP | 1.25 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |