C24H26N4O4 — CID 92575708
(5S)-5-[3-oxo-3-[(6S)-5-oxo-6-[(4-phenylphenyl)methyl]-1,4-diazepan-1-yl]propyl]imidazolidine-2,4-dione (PubChem CID 92575708) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is (5S)-5-[3-oxo-3-[(6S)-5-oxo-6-[(4-phenylphenyl)methyl]-1,4-diazepan-1-yl]propyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[3-oxo-3-[(6S)-5-oxo-6-[(4-phenylphenyl)methyl]-1,4-diazepan-1-yl]propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 92575708 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | (5S)-5-[3-oxo-3-[(6S)-5-oxo-6-[(4-phenylphenyl)methyl]-1,4-diazepan-1-yl]propyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@H](CCC(=O)N2CCNC(=O)[C@@H](Cc3ccc(-c4ccccc4)cc3)C2)N1 |
| InChI | InChI=1S/C24H26N4O4/c29-21(11-10-20-23(31)27-24(32)26-20)28-13-12-25-22(30)19(15-28)14-16-6-8-18(9-7-16)17-4-2-1-3-5-17/h1-9,19-20H,10-15H2,(H,25,30)(H2,26,27,31,32)/t19-,20-/m0/s1 |
| InChIKey | YFNZCYBHAHSIHN-PMACEKPBSA-N |
| XLogP | 1.46 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|