C17H18F2N2O3S2 — CID 9257647
3-(3,4-difluorophenyl)sulfanyl-N-(2,3-dimethyl-5-sulfamoylphenyl)propanamide (PubChem CID 9257647) has the molecular formula C17H18F2N2O3S2 and a molecular weight of 400.47 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)sulfanyl-N-(2,3-dimethyl-5-sulfamoylphenyl)propanamide.
| Compound Name | 3-(3,4-difluorophenyl)sulfanyl-N-(2,3-dimethyl-5-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 9257647 |
| Molecular Formula | C17H18F2N2O3S2 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 3-(3,4-difluorophenyl)sulfanyl-N-(2,3-dimethyl-5-sulfamoylphenyl)propanamide |
| SMILES | Cc1cc(S(N)(=O)=O)cc(NC(=O)CCSc2ccc(F)c(F)c2)c1C |
| InChI | InChI=1S/C17H18F2N2O3S2/c1-10-7-13(26(20,23)24)9-16(11(10)2)21-17(22)5-6-25-12-3-4-14(18)15(19)8-12/h3-4,7-9H,5-6H2,1-2H3,(H,21,22)(H2,20,23,24) |
| InChIKey | ZMLTUXXRHMYXNJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |