C18H19FN4 — CID 92576988
N-(3-fluorophenyl)-1-[(3S)-piperidin-3-yl]imidazo[1,5-a]pyridin-3-amine (PubChem CID 92576988) has the molecular formula C18H19FN4 and a molecular weight of 310.38 g/mol. Its IUPAC name is N-(3-fluorophenyl)-1-[(3S)-piperidin-3-yl]imidazo[1,5-a]pyridin-3-amine.
| Compound Name | N-(3-fluorophenyl)-1-[(3S)-piperidin-3-yl]imidazo[1,5-a]pyridin-3-amine |
|---|---|
| PubChem CID | 92576988 |
| Molecular Formula | C18H19FN4 |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | N-(3-fluorophenyl)-1-[(3S)-piperidin-3-yl]imidazo[1,5-a]pyridin-3-amine |
| SMILES | Fc1cccc(Nc2nc([C@H]3CCCNC3)c3ccccn23)c1 |
| InChI | InChI=1S/C18H19FN4/c19-14-6-3-7-15(11-14)21-18-22-17(13-5-4-9-20-12-13)16-8-1-2-10-23(16)18/h1-3,6-8,10-11,13,20H,4-5,9,12H2,(H,21,22)/t13-/m0/s1 |
| InChIKey | IGERENJSGJNYLS-ZDUSSCGKSA-N |
| XLogP | 3.68 |
| TPSA | 41.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |