C20H23NO3S — CID 9258361
(E)-N-[(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-3-(3-methylthiophen-2-yl)prop-2-enamide (PubChem CID 9258361) has the molecular formula C20H23NO3S and a molecular weight of 357.48 g/mol. Its IUPAC name is (E)-N-[(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-3-(3-methylthiophen-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-3-(3-methylthiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 9258361 |
| Molecular Formula | C20H23NO3S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | (E)-N-[(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-3-(3-methylthiophen-2-yl)prop-2-enamide |
| SMILES | Cc1ccsc1/C=C/C(=O)N[C@@H](c1ccc2c(c1)OCCO2)C(C)C |
| InChI | InChI=1S/C20H23NO3S/c1-13(2)20(15-4-5-16-17(12-15)24-10-9-23-16)21-19(22)7-6-18-14(3)8-11-25-18/h4-8,11-13,20H,9-10H2,1-3H3,(H,21,22)/b7-6+/t20-/m1/s1 |
| InChIKey | PVICTXYTAUVQPB-ROUKRRSUSA-N |
| XLogP | 4.35 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|