C24H30N2O2 — CID 92595522
1-[(4R,4aR,9aR)-4-phenyl-2,3,4,4a,5,6,7,8,9,9a-decahydropyrido[3,2-b]azepin-1-yl]-2-(4-methoxyphenyl)ethanone (PubChem CID 92595522) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 1-[(4R,4aR,9aR)-4-phenyl-2,3,4,4a,5,6,7,8,9,9a-decahydropyrido[3,2-b]azepin-1-yl]-2-(4-methoxyphenyl)ethanone.
| Compound Name | 1-[(4R,4aR,9aR)-4-phenyl-2,3,4,4a,5,6,7,8,9,9a-decahydropyrido[3,2-b]azepin-1-yl]-2-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 92595522 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 1-[(4R,4aR,9aR)-4-phenyl-2,3,4,4a,5,6,7,8,9,9a-decahydropyrido[3,2-b]azepin-1-yl]-2-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(CC(=O)N2CC[C@H](c3ccccc3)[C@H]3NCCCC[C@H]32)cc1 |
| InChI | InChI=1S/C24H30N2O2/c1-28-20-12-10-18(11-13-20)17-23(27)26-16-14-21(19-7-3-2-4-8-19)24-22(26)9-5-6-15-25-24/h2-4,7-8,10-13,21-22,24-25H,5-6,9,14-17H2,1H3/t21-,22-,24-/m1/s1 |
| InChIKey | BMLIIMDJKQMXOD-CQOQZXRMSA-N |
| XLogP | 3.76 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |