C22H26N2O2 — CID 110137634
[(3R,3aS,8aS)-3-phenyl-3,3a,4,5,6,7,8,8a-octahydro-2H-pyrrolo[3,2-b]azepin-1-yl]-(3-methoxyphenyl)methanone (PubChem CID 110137634) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is [(3R,3aS,8aS)-3-phenyl-3,3a,4,5,6,7,8,8a-octahydro-2H-pyrrolo[3,2-b]azepin-1-yl]-(3-methoxyphenyl)methanone.
| Compound Name | [(3R,3aS,8aS)-3-phenyl-3,3a,4,5,6,7,8,8a-octahydro-2H-pyrrolo[3,2-b]azepin-1-yl]-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 110137634 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | [(3R,3aS,8aS)-3-phenyl-3,3a,4,5,6,7,8,8a-octahydro-2H-pyrrolo[3,2-b]azepin-1-yl]-(3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)N2C[C@@H](c3ccccc3)[C@@H]3NCCCC[C@@H]32)c1 |
| InChI | InChI=1S/C22H26N2O2/c1-26-18-11-7-10-17(14-18)22(25)24-15-19(16-8-3-2-4-9-16)21-20(24)12-5-6-13-23-21/h2-4,7-11,14,19-21,23H,5-6,12-13,15H2,1H3/t19-,20-,21-/m0/s1 |
| InChIKey | FBBLPWKTMRBMIS-ACRUOGEOSA-N |
| XLogP | 3.45 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |