C16H19ClN2O2S2 — CID 92603095
5-chloro-3-methylsulfonyl-2-[(3S)-1-(thiophen-2-ylmethyl)piperidin-3-yl]pyridine (PubChem CID 92603095) has the molecular formula C16H19ClN2O2S2 and a molecular weight of 370.93 g/mol. Its IUPAC name is 5-chloro-3-methylsulfonyl-2-[(3S)-1-(thiophen-2-ylmethyl)piperidin-3-yl]pyridine.
| Compound Name | 5-chloro-3-methylsulfonyl-2-[(3S)-1-(thiophen-2-ylmethyl)piperidin-3-yl]pyridine |
|---|---|
| PubChem CID | 92603095 |
| Molecular Formula | C16H19ClN2O2S2 |
| Molecular Weight | 370.93 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 5-chloro-3-methylsulfonyl-2-[(3S)-1-(thiophen-2-ylmethyl)piperidin-3-yl]pyridine |
| SMILES | CS(=O)(=O)c1cc(Cl)cnc1[C@H]1CCCN(Cc2cccs2)C1 |
| InChI | InChI=1S/C16H19ClN2O2S2/c1-23(20,21)15-8-13(17)9-18-16(15)12-4-2-6-19(10-12)11-14-5-3-7-22-14/h3,5,7-9,12H,2,4,6,10-11H2,1H3/t12-/m0/s1 |
| InChIKey | LETYHRIUJJBBSP-LBPRGKRZSA-N |
| XLogP | 3.58 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.93 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |