C17H18Cl2N2O4S2 — CID 95853872
5-chloro-2-[(3S)-1-(4-chlorophenyl)sulfonylpiperidin-3-yl]-3-methylsulfonylpyridine (PubChem CID 95853872) has the molecular formula C17H18Cl2N2O4S2 and a molecular weight of 449.38 g/mol. Its IUPAC name is 5-chloro-2-[(3S)-1-(4-chlorophenyl)sulfonylpiperidin-3-yl]-3-methylsulfonylpyridine.
| Compound Name | 5-chloro-2-[(3S)-1-(4-chlorophenyl)sulfonylpiperidin-3-yl]-3-methylsulfonylpyridine |
|---|---|
| PubChem CID | 95853872 |
| Molecular Formula | C17H18Cl2N2O4S2 |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 448.01 |
| IUPAC Name | 5-chloro-2-[(3S)-1-(4-chlorophenyl)sulfonylpiperidin-3-yl]-3-methylsulfonylpyridine |
| SMILES | CS(=O)(=O)c1cc(Cl)cnc1[C@H]1CCCN(S(=O)(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C17H18Cl2N2O4S2/c1-26(22,23)16-9-14(19)10-20-17(16)12-3-2-8-21(11-12)27(24,25)15-6-4-13(18)5-7-15/h4-7,9-10,12H,2-3,8,11H2,1H3/t12-/m0/s1 |
| InChIKey | PXJRHOJXVKMNMQ-LBPRGKRZSA-N |
| XLogP | 3.36 |
| TPSA | 84.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |