C24H32N4O — CID 92608271
[(4R,4aR,9aR)-5-methyl-4-phenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-1-yl]-(4,5,6,7-tetrahydro-1H-indazol-3-yl)methanone (PubChem CID 92608271) has the molecular formula C24H32N4O and a molecular weight of 392.55 g/mol. Its IUPAC name is [(4R,4aR,9aR)-5-methyl-4-phenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-1-yl]-(4,5,6,7-tetrahydro-1H-indazol-3-yl)methanone.
| Compound Name | [(4R,4aR,9aR)-5-methyl-4-phenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-1-yl]-(4,5,6,7-tetrahydro-1H-indazol-3-yl)methanone |
|---|---|
| PubChem CID | 92608271 |
| Molecular Formula | C24H32N4O |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | [(4R,4aR,9aR)-5-methyl-4-phenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-1-yl]-(4,5,6,7-tetrahydro-1H-indazol-3-yl)methanone |
| SMILES | CN1CCCC[C@@H]2[C@H]1[C@@H](c1ccccc1)CCN2C(=O)c1n[nH]c2c1CCCC2 |
| InChI | InChI=1S/C24H32N4O/c1-27-15-8-7-13-21-23(27)18(17-9-3-2-4-10-17)14-16-28(21)24(29)22-19-11-5-6-12-20(19)25-26-22/h2-4,9-10,18,21,23H,5-8,11-16H2,1H3,(H,25,26)/t18-,21-,23-/m1/s1 |
| InChIKey | YHRWZSDTGNASGZ-JMUQELJHSA-N |
| XLogP | 3.77 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |