C23H28N4O4 — CID 92611211
N-(2-methoxyethyl)-3-[(3R)-1-[(8-methoxyquinolin-2-yl)methyl]piperidin-3-yl]-1,2-oxazole-5-carboxamide (PubChem CID 92611211) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-[(3R)-1-[(8-methoxyquinolin-2-yl)methyl]piperidin-3-yl]-1,2-oxazole-5-carboxamide.
| Compound Name | N-(2-methoxyethyl)-3-[(3R)-1-[(8-methoxyquinolin-2-yl)methyl]piperidin-3-yl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 92611211 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | N-(2-methoxyethyl)-3-[(3R)-1-[(8-methoxyquinolin-2-yl)methyl]piperidin-3-yl]-1,2-oxazole-5-carboxamide |
| SMILES | COCCNC(=O)c1cc([C@@H]2CCCN(Cc3ccc4cccc(OC)c4n3)C2)no1 |
| InChI | InChI=1S/C23H28N4O4/c1-29-12-10-24-23(28)21-13-19(26-31-21)17-6-4-11-27(14-17)15-18-9-8-16-5-3-7-20(30-2)22(16)25-18/h3,5,7-9,13,17H,4,6,10-12,14-15H2,1-2H3,(H,24,28)/t17-/m1/s1 |
| InChIKey | RWOOXNZGDYCWCV-QGZVFWFLSA-N |
| XLogP | 2.99 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|