C18H24N4O3 — CID 92611232
N-(2-methoxyethyl)-3-[(3S)-1-(pyridin-4-ylmethyl)piperidin-3-yl]-1,2-oxazole-5-carboxamide (PubChem CID 92611232) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-[(3S)-1-(pyridin-4-ylmethyl)piperidin-3-yl]-1,2-oxazole-5-carboxamide.
| Compound Name | N-(2-methoxyethyl)-3-[(3S)-1-(pyridin-4-ylmethyl)piperidin-3-yl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 92611232 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | N-(2-methoxyethyl)-3-[(3S)-1-(pyridin-4-ylmethyl)piperidin-3-yl]-1,2-oxazole-5-carboxamide |
| SMILES | COCCNC(=O)c1cc([C@H]2CCCN(Cc3ccncc3)C2)no1 |
| InChI | InChI=1S/C18H24N4O3/c1-24-10-8-20-18(23)17-11-16(21-25-17)15-3-2-9-22(13-15)12-14-4-6-19-7-5-14/h4-7,11,15H,2-3,8-10,12-13H2,1H3,(H,20,23)/t15-/m0/s1 |
| InChIKey | CDNSWPXNSCXWSO-HNNXBMFYSA-N |
| XLogP | 1.83 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|