C23H28N6O3 — CID 92616416
3-[4-[(2S)-2-[2-(dimethylamino)-5-phenylpyrimidin-4-yl]pyrrolidin-1-yl]-4-oxobutyl]imidazolidine-2,4-dione (PubChem CID 92616416) has the molecular formula C23H28N6O3 and a molecular weight of 436.52 g/mol. Its IUPAC name is 3-[4-[(2S)-2-[2-(dimethylamino)-5-phenylpyrimidin-4-yl]pyrrolidin-1-yl]-4-oxobutyl]imidazolidine-2,4-dione.
| Compound Name | 3-[4-[(2S)-2-[2-(dimethylamino)-5-phenylpyrimidin-4-yl]pyrrolidin-1-yl]-4-oxobutyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 92616416 |
| Molecular Formula | C23H28N6O3 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 3-[4-[(2S)-2-[2-(dimethylamino)-5-phenylpyrimidin-4-yl]pyrrolidin-1-yl]-4-oxobutyl]imidazolidine-2,4-dione |
| SMILES | CN(C)c1ncc(-c2ccccc2)c([C@@H]2CCCN2C(=O)CCCN2C(=O)CNC2=O)n1 |
| InChI | InChI=1S/C23H28N6O3/c1-27(2)22-24-14-17(16-8-4-3-5-9-16)21(26-22)18-10-6-12-28(18)19(30)11-7-13-29-20(31)15-25-23(29)32/h3-5,8-9,14,18H,6-7,10-13,15H2,1-2H3,(H,25,32)/t18-/m0/s1 |
| InChIKey | SHUKUFOWSBROIP-SFHVURJKSA-N |
| XLogP | 2.21 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|