C26H24N4O — CID 92619804
3-[(6R)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-N-(2-phenylphenyl)benzamide (PubChem CID 92619804) has the molecular formula C26H24N4O and a molecular weight of 408.51 g/mol. Its IUPAC name is 3-[(6R)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-N-(2-phenylphenyl)benzamide.
| Compound Name | 3-[(6R)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-N-(2-phenylphenyl)benzamide |
|---|---|
| PubChem CID | 92619804 |
| Molecular Formula | C26H24N4O |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 3-[(6R)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-N-(2-phenylphenyl)benzamide |
| SMILES | Cc1nnc2n1C[C@@H](c1cccc(C(=O)Nc3ccccc3-c3ccccc3)c1)CC2 |
| InChI | InChI=1S/C26H24N4O/c1-18-28-29-25-15-14-22(17-30(18)25)20-10-7-11-21(16-20)26(31)27-24-13-6-5-12-23(24)19-8-3-2-4-9-19/h2-13,16,22H,14-15,17H2,1H3,(H,27,31)/t22-/m0/s1 |
| InChIKey | CUHQDIDBTAODPV-QFIPXVFZSA-N |
| XLogP | 5.24 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |