C22H31N5O — CID 92625014
3-[(2R)-1-[(4-cyclopentyloxyphenyl)methyl]pyrrolidin-2-yl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepine (PubChem CID 92625014) has the molecular formula C22H31N5O and a molecular weight of 381.52 g/mol. Its IUPAC name is 3-[(2R)-1-[(4-cyclopentyloxyphenyl)methyl]pyrrolidin-2-yl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepine.
| Compound Name | 3-[(2R)-1-[(4-cyclopentyloxyphenyl)methyl]pyrrolidin-2-yl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepine |
|---|---|
| PubChem CID | 92625014 |
| Molecular Formula | C22H31N5O |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | 3-[(2R)-1-[(4-cyclopentyloxyphenyl)methyl]pyrrolidin-2-yl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepine |
| SMILES | c1cc(OC2CCCC2)ccc1CN1CCC[C@@H]1c1nnc2n1CCNCC2 |
| InChI | InChI=1S/C22H31N5O/c1-2-5-18(4-1)28-19-9-7-17(8-10-19)16-26-14-3-6-20(26)22-25-24-21-11-12-23-13-15-27(21)22/h7-10,18,20,23H,1-6,11-16H2/t20-/m1/s1 |
| InChIKey | IUJVKXWORTZBHH-HXUWFJFHSA-N |
| XLogP | 3.08 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |