C24H27N3O4 — CID 92627226
8-[(2R)-3-(4-methoxyphenyl)-2-phenylpropanoyl]-3-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 92627226) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is 8-[(2R)-3-(4-methoxyphenyl)-2-phenylpropanoyl]-3-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[(2R)-3-(4-methoxyphenyl)-2-phenylpropanoyl]-3-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 92627226 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 8-[(2R)-3-(4-methoxyphenyl)-2-phenylpropanoyl]-3-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | COc1ccc(C[C@@H](C(=O)N2CCC3(CC2)NC(=O)N(C)C3=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H27N3O4/c1-26-22(29)24(25-23(26)30)12-14-27(15-13-24)21(28)20(18-6-4-3-5-7-18)16-17-8-10-19(31-2)11-9-17/h3-11,20H,12-16H2,1-2H3,(H,25,30)/t20-/m1/s1 |
| InChIKey | HYFXKBMJUPGEEY-HXUWFJFHSA-N |
| XLogP | 2.56 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|