C24H31N5O — CID 92627694
N-[(2S)-4-(azepan-1-yl)butan-2-yl]-2-(1-methylpyrazol-3-yl)quinoline-4-carboxamide (PubChem CID 92627694) has the molecular formula C24H31N5O and a molecular weight of 405.55 g/mol. Its IUPAC name is N-[(2S)-4-(azepan-1-yl)butan-2-yl]-2-(1-methylpyrazol-3-yl)quinoline-4-carboxamide.
| Compound Name | N-[(2S)-4-(azepan-1-yl)butan-2-yl]-2-(1-methylpyrazol-3-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 92627694 |
| Molecular Formula | C24H31N5O |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | N-[(2S)-4-(azepan-1-yl)butan-2-yl]-2-(1-methylpyrazol-3-yl)quinoline-4-carboxamide |
| SMILES | C[C@@H](CCN1CCCCCC1)NC(=O)c1cc(-c2ccn(C)n2)nc2ccccc12 |
| InChI | InChI=1S/C24H31N5O/c1-18(11-16-29-13-7-3-4-8-14-29)25-24(30)20-17-23(22-12-15-28(2)27-22)26-21-10-6-5-9-19(20)21/h5-6,9-10,12,15,17-18H,3-4,7-8,11,13-14,16H2,1-2H3,(H,25,30)/t18-/m0/s1 |
| InChIKey | AWSXKQROGIDMSR-SFHVURJKSA-N |
| XLogP | 4.02 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |