C17H26N4O3S — CID 92632719
(4-methylpyrimidin-5-yl)-[4-[(2S)-1-methylsulfonylpiperidin-2-yl]piperidin-1-yl]methanone (PubChem CID 92632719) has the molecular formula C17H26N4O3S and a molecular weight of 366.49 g/mol. Its IUPAC name is (4-methylpyrimidin-5-yl)-[4-[(2S)-1-methylsulfonylpiperidin-2-yl]piperidin-1-yl]methanone.
| Compound Name | (4-methylpyrimidin-5-yl)-[4-[(2S)-1-methylsulfonylpiperidin-2-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 92632719 |
| Molecular Formula | C17H26N4O3S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (4-methylpyrimidin-5-yl)-[4-[(2S)-1-methylsulfonylpiperidin-2-yl]piperidin-1-yl]methanone |
| SMILES | Cc1ncncc1C(=O)N1CCC([C@@H]2CCCCN2S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C17H26N4O3S/c1-13-15(11-18-12-19-13)17(22)20-9-6-14(7-10-20)16-5-3-4-8-21(16)25(2,23)24/h11-12,14,16H,3-10H2,1-2H3/t16-/m0/s1 |
| InChIKey | QYHYRYLBGWEUGZ-INIZCTEOSA-N |
| XLogP | 1.45 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |