C20H26N4O4 — CID 92632863
(2S)-4-(2-ethylpyrazole-3-carbonyl)-N-[2-(2-methoxyphenyl)ethyl]morpholine-2-carboxamide (PubChem CID 92632863) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is (2S)-4-(2-ethylpyrazole-3-carbonyl)-N-[2-(2-methoxyphenyl)ethyl]morpholine-2-carboxamide.
| Compound Name | (2S)-4-(2-ethylpyrazole-3-carbonyl)-N-[2-(2-methoxyphenyl)ethyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 92632863 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | (2S)-4-(2-ethylpyrazole-3-carbonyl)-N-[2-(2-methoxyphenyl)ethyl]morpholine-2-carboxamide |
| SMILES | CCn1nccc1C(=O)N1CCO[C@H](C(=O)NCCc2ccccc2OC)C1 |
| InChI | InChI=1S/C20H26N4O4/c1-3-24-16(9-11-22-24)20(26)23-12-13-28-18(14-23)19(25)21-10-8-15-6-4-5-7-17(15)27-2/h4-7,9,11,18H,3,8,10,12-14H2,1-2H3,(H,21,25)/t18-/m0/s1 |
| InChIKey | MDLNBIZJDXQZKR-SFHVURJKSA-N |
| XLogP | 1.11 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |