C18H21N3O4 — CID 95869619
(2R)-4-(2-methylfuran-3-carbonyl)-N-(2-pyridin-2-ylethyl)morpholine-2-carboxamide (PubChem CID 95869619) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is (2R)-4-(2-methylfuran-3-carbonyl)-N-(2-pyridin-2-ylethyl)morpholine-2-carboxamide.
| Compound Name | (2R)-4-(2-methylfuran-3-carbonyl)-N-(2-pyridin-2-ylethyl)morpholine-2-carboxamide |
|---|---|
| PubChem CID | 95869619 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | (2R)-4-(2-methylfuran-3-carbonyl)-N-(2-pyridin-2-ylethyl)morpholine-2-carboxamide |
| SMILES | Cc1occc1C(=O)N1CCO[C@@H](C(=O)NCCc2ccccn2)C1 |
| InChI | InChI=1S/C18H21N3O4/c1-13-15(6-10-24-13)18(23)21-9-11-25-16(12-21)17(22)20-8-5-14-4-2-3-7-19-14/h2-4,6-7,10,16H,5,8-9,11-12H2,1H3,(H,20,22)/t16-/m1/s1 |
| InChIKey | XLFAZMNBYOIBGR-MRXNPFEDSA-N |
| XLogP | 1.18 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |