C22H23N5O3 — CID 92635651
1-[2-(cyclopentylamino)-2-oxoethyl]-6-oxo-N-(3-pyrazol-1-ylphenyl)pyridine-3-carboxamide (PubChem CID 92635651) has the molecular formula C22H23N5O3 and a molecular weight of 405.46 g/mol. Its IUPAC name is 1-[2-(cyclopentylamino)-2-oxoethyl]-6-oxo-N-(3-pyrazol-1-ylphenyl)pyridine-3-carboxamide.
| Compound Name | 1-[2-(cyclopentylamino)-2-oxoethyl]-6-oxo-N-(3-pyrazol-1-ylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 92635651 |
| Molecular Formula | C22H23N5O3 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 1-[2-(cyclopentylamino)-2-oxoethyl]-6-oxo-N-(3-pyrazol-1-ylphenyl)pyridine-3-carboxamide |
| SMILES | O=C(Cn1cc(C(=O)Nc2cccc(-n3cccn3)c2)ccc1=O)NC1CCCC1 |
| InChI | InChI=1S/C22H23N5O3/c28-20(24-17-5-1-2-6-17)15-26-14-16(9-10-21(26)29)22(30)25-18-7-3-8-19(13-18)27-12-4-11-23-27/h3-4,7-14,17H,1-2,5-6,15H2,(H,24,28)(H,25,30) |
| InChIKey | FKKRPMISMNINMK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |