C22H20ClN3 — CID 92635754
4-[1-[(4-chlorophenyl)methyl]-5,6-dimethylbenzimidazol-2-yl]aniline (PubChem CID 92635754) has the molecular formula C22H20ClN3 and a molecular weight of 361.88 g/mol. Its IUPAC name is 4-[1-[(4-chlorophenyl)methyl]-5,6-dimethylbenzimidazol-2-yl]aniline.
| Compound Name | 4-[1-[(4-chlorophenyl)methyl]-5,6-dimethylbenzimidazol-2-yl]aniline |
|---|---|
| PubChem CID | 92635754 |
| Molecular Formula | C22H20ClN3 |
| Molecular Weight | 361.88 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 4-[1-[(4-chlorophenyl)methyl]-5,6-dimethylbenzimidazol-2-yl]aniline |
| SMILES | Cc1cc2nc(-c3ccc(N)cc3)n(Cc3ccc(Cl)cc3)c2cc1C |
| InChI | InChI=1S/C22H20ClN3/c1-14-11-20-21(12-15(14)2)26(13-16-3-7-18(23)8-4-16)22(25-20)17-5-9-19(24)10-6-17/h3-12H,13,24H2,1-2H3 |
| InChIKey | ILFIKHGVPSFZAJ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.88 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|