C18H17ClN2 — CID 90769380
1-[(4-chlorophenyl)methyl]-2-ethenyl-5,6-dimethylbenzimidazole (PubChem CID 90769380) has the molecular formula C18H17ClN2 and a molecular weight of 296.80 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-2-ethenyl-5,6-dimethylbenzimidazole.
| Compound Name | 1-[(4-chlorophenyl)methyl]-2-ethenyl-5,6-dimethylbenzimidazole |
|---|---|
| PubChem CID | 90769380 |
| Molecular Formula | C18H17ClN2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-2-ethenyl-5,6-dimethylbenzimidazole |
| SMILES | C=Cc1nc2cc(C)c(C)cc2n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H17ClN2/c1-4-18-20-16-9-12(2)13(3)10-17(16)21(18)11-14-5-7-15(19)8-6-14/h4-10H,1,11H2,2-3H3 |
| InChIKey | FBIBVKAAHDEXAA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |