C24H32N4O — CID 92636232
N-(2-cyclopentylethyl)-6-[(3R)-1-(pyridin-2-ylmethyl)piperidin-3-yl]pyridine-3-carboxamide (PubChem CID 92636232) has the molecular formula C24H32N4O and a molecular weight of 392.55 g/mol. Its IUPAC name is N-(2-cyclopentylethyl)-6-[(3R)-1-(pyridin-2-ylmethyl)piperidin-3-yl]pyridine-3-carboxamide.
| Compound Name | N-(2-cyclopentylethyl)-6-[(3R)-1-(pyridin-2-ylmethyl)piperidin-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 92636232 |
| Molecular Formula | C24H32N4O |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | N-(2-cyclopentylethyl)-6-[(3R)-1-(pyridin-2-ylmethyl)piperidin-3-yl]pyridine-3-carboxamide |
| SMILES | O=C(NCCC1CCCC1)c1ccc([C@@H]2CCCN(Cc3ccccn3)C2)nc1 |
| InChI | InChI=1S/C24H32N4O/c29-24(26-14-12-19-6-1-2-7-19)20-10-11-23(27-16-20)21-8-5-15-28(17-21)18-22-9-3-4-13-25-22/h3-4,9-11,13,16,19,21H,1-2,5-8,12,14-15,17-18H2,(H,26,29)/t21-/m1/s1 |
| InChIKey | WDHFUOBKQUVOGC-OAQYLSRUSA-N |
| XLogP | 4.17 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |