C20H23BrN2O3 — CID 9263688
methyl 4-[[[2-[[(1R)-1-(4-bromophenyl)propyl]amino]acetyl]amino]methyl]benzoate (PubChem CID 9263688) has the molecular formula C20H23BrN2O3 and a molecular weight of 419.32 g/mol. Its IUPAC name is methyl 4-[[[2-[[(1R)-1-(4-bromophenyl)propyl]amino]acetyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[2-[[(1R)-1-(4-bromophenyl)propyl]amino]acetyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 9263688 |
| Molecular Formula | C20H23BrN2O3 |
| Molecular Weight | 419.32 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | methyl 4-[[[2-[[(1R)-1-(4-bromophenyl)propyl]amino]acetyl]amino]methyl]benzoate |
| SMILES | CC[C@@H](NCC(=O)NCc1ccc(C(=O)OC)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H23BrN2O3/c1-3-18(15-8-10-17(21)11-9-15)22-13-19(24)23-12-14-4-6-16(7-5-14)20(25)26-2/h4-11,18,22H,3,12-13H2,1-2H3,(H,23,24)/t18-/m1/s1 |
| InChIKey | QFSPNQBJICJWMZ-GOSISDBHSA-N |
| XLogP | 3.59 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |