C19H20ClN3O4 — CID 51968939
methyl 4-[[[(3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoyl]amino]methyl]benzoate (PubChem CID 51968939) has the molecular formula C19H20ClN3O4 and a molecular weight of 389.84 g/mol. Its IUPAC name is methyl 4-[[[(3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[(3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 51968939 |
| Molecular Formula | C19H20ClN3O4 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | methyl 4-[[[(3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)C[C@H](NC(N)=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H20ClN3O4/c1-27-18(25)14-4-2-12(3-5-14)11-22-17(24)10-16(23-19(21)26)13-6-8-15(20)9-7-13/h2-9,16H,10-11H2,1H3,(H,22,24)(H3,21,23,26)/t16-/m0/s1 |
| InChIKey | JFVVVPALEVBDSX-INIZCTEOSA-N |
| XLogP | 2.54 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |