C15H13BrCl3N3O2S — CID 92640847
5-bromo-N-[(1R)-2,2,2-trichloro-1-[(2-methylphenyl)carbamothioylamino]ethyl]furan-2-carboxamide (PubChem CID 92640847) has the molecular formula C15H13BrCl3N3O2S and a molecular weight of 485.62 g/mol. Its IUPAC name is 5-bromo-N-[(1R)-2,2,2-trichloro-1-[(2-methylphenyl)carbamothioylamino]ethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[(1R)-2,2,2-trichloro-1-[(2-methylphenyl)carbamothioylamino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 92640847 |
| Molecular Formula | C15H13BrCl3N3O2S |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 482.90 |
| IUPAC Name | 5-bromo-N-[(1R)-2,2,2-trichloro-1-[(2-methylphenyl)carbamothioylamino]ethyl]furan-2-carboxamide |
| SMILES | Cc1ccccc1NC(=S)N[C@@H](NC(=O)c1ccc(Br)o1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H13BrCl3N3O2S/c1-8-4-2-3-5-9(8)20-14(25)22-13(15(17,18)19)21-12(23)10-6-7-11(16)24-10/h2-7,13H,1H3,(H,21,23)(H2,20,22,25)/t13-/m1/s1 |
| InChIKey | XEQPAVFAWVHMRS-CYBMUJFWSA-N |
| XLogP | 4.76 |
| TPSA | 66.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|