C17H24FNO2 — CID 92646146
(2S)-1-(3,3-dimethylpiperidin-1-yl)-2-(4-fluorophenoxy)butan-1-one (PubChem CID 92646146) has the molecular formula C17H24FNO2 and a molecular weight of 293.38 g/mol. Its IUPAC name is (2S)-1-(3,3-dimethylpiperidin-1-yl)-2-(4-fluorophenoxy)butan-1-one.
| Compound Name | (2S)-1-(3,3-dimethylpiperidin-1-yl)-2-(4-fluorophenoxy)butan-1-one |
|---|---|
| PubChem CID | 92646146 |
| Molecular Formula | C17H24FNO2 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (2S)-1-(3,3-dimethylpiperidin-1-yl)-2-(4-fluorophenoxy)butan-1-one |
| SMILES | CC[C@H](Oc1ccc(F)cc1)C(=O)N1CCCC(C)(C)C1 |
| InChI | InChI=1S/C17H24FNO2/c1-4-15(21-14-8-6-13(18)7-9-14)16(20)19-11-5-10-17(2,3)12-19/h6-9,15H,4-5,10-12H2,1-3H3/t15-/m0/s1 |
| InChIKey | QOYXEMLDLNEWCL-HNNXBMFYSA-N |
| XLogP | 3.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |