C21H15N3O4S — CID 92648749
methyl 5-[(6-oxo-2-phenyl-1H-pyrimidine-5-carbonyl)amino]-1-benzothiophene-2-carboxylate (PubChem CID 92648749) has the molecular formula C21H15N3O4S and a molecular weight of 405.44 g/mol. Its IUPAC name is methyl 5-[(6-oxo-2-phenyl-1H-pyrimidine-5-carbonyl)amino]-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 5-[(6-oxo-2-phenyl-1H-pyrimidine-5-carbonyl)amino]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 92648749 |
| Molecular Formula | C21H15N3O4S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | methyl 5-[(6-oxo-2-phenyl-1H-pyrimidine-5-carbonyl)amino]-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1cc2cc(NC(=O)c3cnc(-c4ccccc4)[nH]c3=O)ccc2s1 |
| InChI | InChI=1S/C21H15N3O4S/c1-28-21(27)17-10-13-9-14(7-8-16(13)29-17)23-19(25)15-11-22-18(24-20(15)26)12-5-3-2-4-6-12/h2-11H,1H3,(H,23,25)(H,22,24,26) |
| InChIKey | NDMXNBWGXOIQMU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |