C24H24ClN3O2 — CID 92648935
5-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-2-(4-chlorophenyl)-1H-pyrimidin-6-one (PubChem CID 92648935) has the molecular formula C24H24ClN3O2 and a molecular weight of 421.93 g/mol. Its IUPAC name is 5-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-2-(4-chlorophenyl)-1H-pyrimidin-6-one.
| Compound Name | 5-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-2-(4-chlorophenyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 92648935 |
| Molecular Formula | C24H24ClN3O2 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 5-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-2-(4-chlorophenyl)-1H-pyrimidin-6-one |
| SMILES | O=C(Cc1cnc(-c2ccc(Cl)cc2)[nH]c1=O)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H24ClN3O2/c25-21-8-6-19(7-9-21)23-26-16-20(24(30)27-23)15-22(29)28-12-10-18(11-13-28)14-17-4-2-1-3-5-17/h1-9,16,18H,10-15H2,(H,26,27,30) |
| InChIKey | UCCXWBFLNRFDAC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |