C23H23ClN4O2 — CID 92648941
5-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-2-(4-chlorophenyl)-1H-pyrimidin-6-one (PubChem CID 92648941) has the molecular formula C23H23ClN4O2 and a molecular weight of 422.92 g/mol. Its IUPAC name is 5-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-2-(4-chlorophenyl)-1H-pyrimidin-6-one.
| Compound Name | 5-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-2-(4-chlorophenyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 92648941 |
| Molecular Formula | C23H23ClN4O2 |
| Molecular Weight | 422.92 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 5-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-2-(4-chlorophenyl)-1H-pyrimidin-6-one |
| SMILES | O=C(Cc1cnc(-c2ccc(Cl)cc2)[nH]c1=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H23ClN4O2/c24-20-8-6-18(7-9-20)22-25-15-19(23(30)26-22)14-21(29)28-12-10-27(11-13-28)16-17-4-2-1-3-5-17/h1-9,15H,10-14,16H2,(H,25,26,30) |
| InChIKey | BVQLIGFRYWECDL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.92 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |