C32H44N4O3 — CID 92652962
(3R,4R)-2-cyclohexyl-N-[3-(4-ethylpiperazin-1-yl)propyl]-3-(4-methoxyphenyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 92652962) has the molecular formula C32H44N4O3 and a molecular weight of 532.73 g/mol. Its IUPAC name is (3R,4R)-2-cyclohexyl-N-[3-(4-ethylpiperazin-1-yl)propyl]-3-(4-methoxyphenyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3R,4R)-2-cyclohexyl-N-[3-(4-ethylpiperazin-1-yl)propyl]-3-(4-methoxyphenyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 92652962 |
| Molecular Formula | C32H44N4O3 |
| Molecular Weight | 532.73 g/mol |
| Exact Mass | 532.34 |
| IUPAC Name | (3R,4R)-2-cyclohexyl-N-[3-(4-ethylpiperazin-1-yl)propyl]-3-(4-methoxyphenyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | CCN1CCN(CCCNC(=O)[C@@H]2c3ccccc3C(=O)N(C3CCCCC3)[C@H]2c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C32H44N4O3/c1-3-34-20-22-35(23-21-34)19-9-18-33-31(37)29-27-12-7-8-13-28(27)32(38)36(25-10-5-4-6-11-25)30(29)24-14-16-26(39-2)17-15-24/h7-8,12-17,25,29-30H,3-6,9-11,18-23H2,1-2H3,(H,33,37)/t29-,30+/m1/s1 |
| InChIKey | LZKJMVICTQPITL-IHLOFXLRSA-N |
| XLogP | 4.45 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.73 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|