C35H43N3O3 — CID 98177681
(3S,4S)-2-cyclohexyl-N-[3-(N-ethyl-3-methylanilino)propyl]-3-(4-methoxyphenyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 98177681) has the molecular formula C35H43N3O3 and a molecular weight of 553.75 g/mol. Its IUPAC name is (3S,4S)-2-cyclohexyl-N-[3-(N-ethyl-3-methylanilino)propyl]-3-(4-methoxyphenyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3S,4S)-2-cyclohexyl-N-[3-(N-ethyl-3-methylanilino)propyl]-3-(4-methoxyphenyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 98177681 |
| Molecular Formula | C35H43N3O3 |
| Molecular Weight | 553.75 g/mol |
| Exact Mass | 553.33 |
| IUPAC Name | (3S,4S)-2-cyclohexyl-N-[3-(N-ethyl-3-methylanilino)propyl]-3-(4-methoxyphenyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | CCN(CCCNC(=O)[C@H]1c2ccccc2C(=O)N(C2CCCCC2)[C@@H]1c1ccc(OC)cc1)c1cccc(C)c1 |
| InChI | InChI=1S/C35H43N3O3/c1-4-37(28-15-10-12-25(2)24-28)23-11-22-36-34(39)32-30-16-8-9-17-31(30)35(40)38(27-13-6-5-7-14-27)33(32)26-18-20-29(41-3)21-19-26/h8-10,12,15-21,24,27,32-33H,4-7,11,13-14,22-23H2,1-3H3,(H,36,39)/t32-,33+/m0/s1 |
| InChIKey | SEWTVRIAWUSVQU-JHOUSYSJSA-N |
| XLogP | 6.65 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.75 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|