C7H10ClN3O2S — CID 92660576
(2R)-2-chloro-N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 92660576) has the molecular formula C7H10ClN3O2S and a molecular weight of 235.70 g/mol. Its IUPAC name is (2R)-2-chloro-N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | (2R)-2-chloro-N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 92660576 |
| Molecular Formula | C7H10ClN3O2S |
| Molecular Weight | 235.70 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | (2R)-2-chloro-N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | COCc1nnc(NC(=O)[C@@H](C)Cl)s1 |
| InChI | InChI=1S/C7H10ClN3O2S/c1-4(8)6(12)9-7-11-10-5(14-7)3-13-2/h4H,3H2,1-2H3,(H,9,11,12)/t4-/m1/s1 |
| InChIKey | FHTNSXGLVZNKSS-SCSAIBSYSA-N |
| XLogP | 1.25 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.70 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|