C23H29N3O3 — CID 92665737
1-[5-[(1S)-1-hydroxy-2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-2,3-dihydroindol-1-yl]ethanone (PubChem CID 92665737) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is 1-[5-[(1S)-1-hydroxy-2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-2,3-dihydroindol-1-yl]ethanone.
| Compound Name | 1-[5-[(1S)-1-hydroxy-2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-2,3-dihydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 92665737 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 1-[5-[(1S)-1-hydroxy-2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-2,3-dihydroindol-1-yl]ethanone |
| SMILES | COc1ccc(N2CCN(C[C@@H](O)c3ccc4c(c3)CCN4C(C)=O)CC2)cc1 |
| InChI | InChI=1S/C23H29N3O3/c1-17(27)26-10-9-18-15-19(3-8-22(18)26)23(28)16-24-11-13-25(14-12-24)20-4-6-21(29-2)7-5-20/h3-8,15,23,28H,9-14,16H2,1-2H3/t23-/m1/s1 |
| InChIKey | YXEDHLVASDSUSQ-HSZRJFAPSA-N |
| XLogP | 2.46 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|