C20H30N4O3 — CID 92667632
N-[3-(4-ethylpiperazin-1-yl)propyl]-2-[(2S)-6-methyl-3-oxo-4H-1,4-benzoxazin-2-yl]acetamide (PubChem CID 92667632) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is N-[3-(4-ethylpiperazin-1-yl)propyl]-2-[(2S)-6-methyl-3-oxo-4H-1,4-benzoxazin-2-yl]acetamide.
| Compound Name | N-[3-(4-ethylpiperazin-1-yl)propyl]-2-[(2S)-6-methyl-3-oxo-4H-1,4-benzoxazin-2-yl]acetamide |
|---|---|
| PubChem CID | 92667632 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | N-[3-(4-ethylpiperazin-1-yl)propyl]-2-[(2S)-6-methyl-3-oxo-4H-1,4-benzoxazin-2-yl]acetamide |
| SMILES | CCN1CCN(CCCNC(=O)C[C@@H]2Oc3ccc(C)cc3NC2=O)CC1 |
| InChI | InChI=1S/C20H30N4O3/c1-3-23-9-11-24(12-10-23)8-4-7-21-19(25)14-18-20(26)22-16-13-15(2)5-6-17(16)27-18/h5-6,13,18H,3-4,7-12,14H2,1-2H3,(H,21,25)(H,22,26)/t18-/m0/s1 |
| InChIKey | VLYFWSBFWCWQNA-SFHVURJKSA-N |
| XLogP | 1.23 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|