C24H31N3O3 — CID 20881738
N-[3-[benzyl(propan-2-yl)amino]propyl]-2-(6-methyl-3-oxo-4H-1,4-benzoxazin-2-yl)acetamide (PubChem CID 20881738) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is N-[3-[benzyl(propan-2-yl)amino]propyl]-2-(6-methyl-3-oxo-4H-1,4-benzoxazin-2-yl)acetamide.
| Compound Name | N-[3-[benzyl(propan-2-yl)amino]propyl]-2-(6-methyl-3-oxo-4H-1,4-benzoxazin-2-yl)acetamide |
|---|---|
| PubChem CID | 20881738 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | N-[3-[benzyl(propan-2-yl)amino]propyl]-2-(6-methyl-3-oxo-4H-1,4-benzoxazin-2-yl)acetamide |
| SMILES | Cc1ccc2c(c1)NC(=O)C(CC(=O)NCCCN(Cc1ccccc1)C(C)C)O2 |
| InChI | InChI=1S/C24H31N3O3/c1-17(2)27(16-19-8-5-4-6-9-19)13-7-12-25-23(28)15-22-24(29)26-20-14-18(3)10-11-21(20)30-22/h4-6,8-11,14,17,22H,7,12-13,15-16H2,1-3H3,(H,25,28)(H,26,29) |
| InChIKey | GHYLIXUYOIGJSH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|