C18H27N5O2 — CID 92667941
N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-4-(5-methyl-8-oxoimidazo[1,2-d][1,2,4]triazin-7-yl)butanamide (PubChem CID 92667941) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-4-(5-methyl-8-oxoimidazo[1,2-d][1,2,4]triazin-7-yl)butanamide.
| Compound Name | N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-4-(5-methyl-8-oxoimidazo[1,2-d][1,2,4]triazin-7-yl)butanamide |
|---|---|
| PubChem CID | 92667941 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-4-(5-methyl-8-oxoimidazo[1,2-d][1,2,4]triazin-7-yl)butanamide |
| SMILES | Cc1nn(CCCC(=O)N[C@@H]2CCC[C@@H](C)[C@H]2C)c(=O)c2nccn12 |
| InChI | InChI=1S/C18H27N5O2/c1-12-6-4-7-15(13(12)2)20-16(24)8-5-10-23-18(25)17-19-9-11-22(17)14(3)21-23/h9,11-13,15H,4-8,10H2,1-3H3,(H,20,24)/t12-,13-,15-/m1/s1 |
| InChIKey | RJIPDKGKYPCYNI-UMVBOHGHSA-N |
| XLogP | 1.92 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |