C16H15NO6S — CID 92671973
methyl 4-(1,3-benzodioxol-5-ylsulfamoylmethyl)benzoate (PubChem CID 92671973) has the molecular formula C16H15NO6S and a molecular weight of 349.36 g/mol. Its IUPAC name is methyl 4-(1,3-benzodioxol-5-ylsulfamoylmethyl)benzoate.
| Compound Name | methyl 4-(1,3-benzodioxol-5-ylsulfamoylmethyl)benzoate |
|---|---|
| PubChem CID | 92671973 |
| Molecular Formula | C16H15NO6S |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | methyl 4-(1,3-benzodioxol-5-ylsulfamoylmethyl)benzoate |
| SMILES | COC(=O)c1ccc(CS(=O)(=O)Nc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C16H15NO6S/c1-21-16(18)12-4-2-11(3-5-12)9-24(19,20)17-13-6-7-14-15(8-13)23-10-22-14/h2-8,17H,9-10H2,1H3 |
| InChIKey | PXXNVMGZILHWJQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |