C17H16ClIN2O4S — CID 92672997
(2R)-6-chloro-N-(4-iodo-2-methylphenyl)-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 92672997) has the molecular formula C17H16ClIN2O4S and a molecular weight of 506.75 g/mol. Its IUPAC name is (2R)-6-chloro-N-(4-iodo-2-methylphenyl)-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | (2R)-6-chloro-N-(4-iodo-2-methylphenyl)-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 92672997 |
| Molecular Formula | C17H16ClIN2O4S |
| Molecular Weight | 506.75 g/mol |
| Exact Mass | 505.96 |
| IUPAC Name | (2R)-6-chloro-N-(4-iodo-2-methylphenyl)-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | Cc1cc(I)ccc1NC(=O)[C@H]1CN(S(C)(=O)=O)c2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C17H16ClIN2O4S/c1-10-7-12(19)4-5-13(10)20-17(22)16-9-21(26(2,23)24)14-8-11(18)3-6-15(14)25-16/h3-8,16H,9H2,1-2H3,(H,20,22)/t16-/m1/s1 |
| InChIKey | RRNLYRPVILGHGT-MRXNPFEDSA-N |
| XLogP | 3.42 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.75 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|