C16H14ClIN2O4S — CID 93490863
(2S)-6-chloro-N-(4-iodophenyl)-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 93490863) has the molecular formula C16H14ClIN2O4S and a molecular weight of 492.72 g/mol. Its IUPAC name is (2S)-6-chloro-N-(4-iodophenyl)-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | (2S)-6-chloro-N-(4-iodophenyl)-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 93490863 |
| Molecular Formula | C16H14ClIN2O4S |
| Molecular Weight | 492.72 g/mol |
| Exact Mass | 491.94 |
| IUPAC Name | (2S)-6-chloro-N-(4-iodophenyl)-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | CS(=O)(=O)N1C[C@@H](C(=O)Nc2ccc(I)cc2)Oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C16H14ClIN2O4S/c1-25(22,23)20-9-15(24-14-7-2-10(17)8-13(14)20)16(21)19-12-5-3-11(18)4-6-12/h2-8,15H,9H2,1H3,(H,19,21)/t15-/m0/s1 |
| InChIKey | GENKXDZYCVNOMF-HNNXBMFYSA-N |
| XLogP | 3.11 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.72 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|