C24H33NO3 — CID 92676986
(2R)-2-(2,3-dimethylphenoxy)-N-[3-(4-propan-2-yloxyphenyl)propyl]butanamide (PubChem CID 92676986) has the molecular formula C24H33NO3 and a molecular weight of 383.53 g/mol. Its IUPAC name is (2R)-2-(2,3-dimethylphenoxy)-N-[3-(4-propan-2-yloxyphenyl)propyl]butanamide.
| Compound Name | (2R)-2-(2,3-dimethylphenoxy)-N-[3-(4-propan-2-yloxyphenyl)propyl]butanamide |
|---|---|
| PubChem CID | 92676986 |
| Molecular Formula | C24H33NO3 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | (2R)-2-(2,3-dimethylphenoxy)-N-[3-(4-propan-2-yloxyphenyl)propyl]butanamide |
| SMILES | CC[C@@H](Oc1cccc(C)c1C)C(=O)NCCCc1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C24H33NO3/c1-6-22(28-23-11-7-9-18(4)19(23)5)24(26)25-16-8-10-20-12-14-21(15-13-20)27-17(2)3/h7,9,11-15,17,22H,6,8,10,16H2,1-5H3,(H,25,26)/t22-/m1/s1 |
| InChIKey | UTMATPZLZNHNDA-JOCHJYFZSA-N |
| XLogP | 5.00 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|