C26H40N4O3 — CID 92678832
4-[(2S)-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl]-4-oxo-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]butanamide (PubChem CID 92678832) has the molecular formula C26H40N4O3 and a molecular weight of 456.63 g/mol. Its IUPAC name is 4-[(2S)-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl]-4-oxo-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]butanamide.
| Compound Name | 4-[(2S)-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl]-4-oxo-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]butanamide |
|---|---|
| PubChem CID | 92678832 |
| Molecular Formula | C26H40N4O3 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.31 |
| IUPAC Name | 4-[(2S)-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl]-4-oxo-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]butanamide |
| SMILES | C[C@H]1CN(C(=O)CCC(=O)NCCCN2CCC(N3CCCCC3)CC2)c2ccccc2O1 |
| InChI | InChI=1S/C26H40N4O3/c1-21-20-30(23-8-3-4-9-24(23)33-21)26(32)11-10-25(31)27-14-7-15-28-18-12-22(13-19-28)29-16-5-2-6-17-29/h3-4,8-9,21-22H,2,5-7,10-20H2,1H3,(H,27,31)/t21-/m0/s1 |
| InChIKey | LBYJHJSKDFDTQH-NRFANRHFSA-N |
| XLogP | 3.04 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|