C28H38N4O3 — CID 92678835
N-[3-[4-(2,5-dimethylphenyl)piperazin-1-yl]propyl]-4-[(2R)-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl]-4-oxobutanamide (PubChem CID 92678835) has the molecular formula C28H38N4O3 and a molecular weight of 478.64 g/mol. Its IUPAC name is N-[3-[4-(2,5-dimethylphenyl)piperazin-1-yl]propyl]-4-[(2R)-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl]-4-oxobutanamide.
| Compound Name | N-[3-[4-(2,5-dimethylphenyl)piperazin-1-yl]propyl]-4-[(2R)-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl]-4-oxobutanamide |
|---|---|
| PubChem CID | 92678835 |
| Molecular Formula | C28H38N4O3 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | N-[3-[4-(2,5-dimethylphenyl)piperazin-1-yl]propyl]-4-[(2R)-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl]-4-oxobutanamide |
| SMILES | Cc1ccc(C)c(N2CCN(CCCNC(=O)CCC(=O)N3C[C@@H](C)Oc4ccccc43)CC2)c1 |
| InChI | InChI=1S/C28H38N4O3/c1-21-9-10-22(2)25(19-21)31-17-15-30(16-18-31)14-6-13-29-27(33)11-12-28(34)32-20-23(3)35-26-8-5-4-7-24(26)32/h4-5,7-10,19,23H,6,11-18,20H2,1-3H3,(H,29,33)/t23-/m1/s1 |
| InChIKey | OXBRHBQTQFEJOF-HSZRJFAPSA-N |
| XLogP | 3.53 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|