C17H19NO3 — CID 92686737
3-(3,4-dimethylphenyl)-4-[[(2S)-oxolan-2-yl]methylamino]cyclobut-3-ene-1,2-dione (PubChem CID 92686737) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-4-[[(2S)-oxolan-2-yl]methylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(3,4-dimethylphenyl)-4-[[(2S)-oxolan-2-yl]methylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 92686737 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-4-[[(2S)-oxolan-2-yl]methylamino]cyclobut-3-ene-1,2-dione |
| SMILES | Cc1ccc(-c2c(NC[C@@H]3CCCO3)c(=O)c2=O)cc1C |
| InChI | InChI=1S/C17H19NO3/c1-10-5-6-12(8-11(10)2)14-15(17(20)16(14)19)18-9-13-4-3-7-21-13/h5-6,8,13,18H,3-4,7,9H2,1-2H3/t13-/m0/s1 |
| InChIKey | GGDWSWMYWCPXIL-ZDUSSCGKSA-N |
| XLogP | 2.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|