C20H20N2O4 — CID 92688363
ethyl 2-[[(2R)-2-(3-oxo-1H-isoindol-2-yl)-2-phenylacetyl]amino]acetate (PubChem CID 92688363) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is ethyl 2-[[(2R)-2-(3-oxo-1H-isoindol-2-yl)-2-phenylacetyl]amino]acetate.
| Compound Name | ethyl 2-[[(2R)-2-(3-oxo-1H-isoindol-2-yl)-2-phenylacetyl]amino]acetate |
|---|---|
| PubChem CID | 92688363 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | ethyl 2-[[(2R)-2-(3-oxo-1H-isoindol-2-yl)-2-phenylacetyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)[C@@H](c1ccccc1)N1Cc2ccccc2C1=O |
| InChI | InChI=1S/C20H20N2O4/c1-2-26-17(23)12-21-19(24)18(14-8-4-3-5-9-14)22-13-15-10-6-7-11-16(15)20(22)25/h3-11,18H,2,12-13H2,1H3,(H,21,24)/t18-/m1/s1 |
| InChIKey | OKLACFMRXPYDKS-GOSISDBHSA-N |
| XLogP | 2.06 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |