C24H19N3O3 — CID 9268843
N-[4-(2-oxopyrrolidin-1-yl)phenyl]-3-phenyl-2,1-benzoxazole-5-carboxamide (PubChem CID 9268843) has the molecular formula C24H19N3O3 and a molecular weight of 397.43 g/mol. Its IUPAC name is N-[4-(2-oxopyrrolidin-1-yl)phenyl]-3-phenyl-2,1-benzoxazole-5-carboxamide.
| Compound Name | N-[4-(2-oxopyrrolidin-1-yl)phenyl]-3-phenyl-2,1-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 9268843 |
| Molecular Formula | C24H19N3O3 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | N-[4-(2-oxopyrrolidin-1-yl)phenyl]-3-phenyl-2,1-benzoxazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCC2=O)cc1)c1ccc2noc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C24H19N3O3/c28-22-7-4-14-27(22)19-11-9-18(10-12-19)25-24(29)17-8-13-21-20(15-17)23(30-26-21)16-5-2-1-3-6-16/h1-3,5-6,8-13,15H,4,7,14H2,(H,25,29) |
| InChIKey | GABTVXTUKKMIQO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |