C19H18ClFN2O4S — CID 92688803
(2R)-N-(3-chloro-4-fluorophenyl)-4-methylsulfonyl-2-(3-oxo-1H-isoindol-2-yl)butanamide (PubChem CID 92688803) has the molecular formula C19H18ClFN2O4S and a molecular weight of 424.88 g/mol. Its IUPAC name is (2R)-N-(3-chloro-4-fluorophenyl)-4-methylsulfonyl-2-(3-oxo-1H-isoindol-2-yl)butanamide.
| Compound Name | (2R)-N-(3-chloro-4-fluorophenyl)-4-methylsulfonyl-2-(3-oxo-1H-isoindol-2-yl)butanamide |
|---|---|
| PubChem CID | 92688803 |
| Molecular Formula | C19H18ClFN2O4S |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | (2R)-N-(3-chloro-4-fluorophenyl)-4-methylsulfonyl-2-(3-oxo-1H-isoindol-2-yl)butanamide |
| SMILES | CS(=O)(=O)CC[C@H](C(=O)Nc1ccc(F)c(Cl)c1)N1Cc2ccccc2C1=O |
| InChI | InChI=1S/C19H18ClFN2O4S/c1-28(26,27)9-8-17(18(24)22-13-6-7-16(21)15(20)10-13)23-11-12-4-2-3-5-14(12)19(23)25/h2-7,10,17H,8-9,11H2,1H3,(H,22,24)/t17-/m1/s1 |
| InChIKey | OULGTROOVLGTJB-QGZVFWFLSA-N |
| XLogP | 2.88 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |