C20H23N5O2 — CID 9269227
(E)-N-[(2S)-1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl]-3-phenylprop-2-enamide (PubChem CID 9269227) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is (E)-N-[(2S)-1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(2S)-1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 9269227 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | (E)-N-[(2S)-1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl]-3-phenylprop-2-enamide |
| SMILES | C[C@H](NC(=O)/C=C/c1ccccc1)C(=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C20H23N5O2/c1-16(23-18(26)9-8-17-6-3-2-4-7-17)19(27)24-12-14-25(15-13-24)20-21-10-5-11-22-20/h2-11,16H,12-15H2,1H3,(H,23,26)/b9-8+/t16-/m0/s1 |
| InChIKey | JAXFAOCFNQLLGW-FDMDGMSGSA-N |
| XLogP | 1.34 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|